C6H11N2O4- — CID 153456088
N-[(4S)-4-amino-4-carboxybutyl]carbamate (PubChem CID 153456088) has the molecular formula C6H11N2O4- and a molecular weight of 175.16 g/mol. Its IUPAC name is N-[(4S)-4-amino-4-carboxybutyl]carbamate.
| Compound Name | N-[(4S)-4-amino-4-carboxybutyl]carbamate |
|---|---|
| PubChem CID | 153456088 |
| Molecular Formula | C6H11N2O4- |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | N-[(4S)-4-amino-4-carboxybutyl]carbamate |
| SMILES | N[C@@H](CCCNC(=O)[O-])C(=O)O |
| InChI | InChI=1S/C6H12N2O4/c7-4(5(9)10)2-1-3-8-6(11)12/h4,8H,1-3,7H2,(H,9,10)(H,11,12)/p-1/t4-/m0/s1 |
| InChIKey | MTZAWKCEDIEEPL-BYPYZUCNSA-M |
| XLogP | -1.89 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|