C7H16N6O6 — CID 131884668
(2S)-2-amino-5-(diaminomethylidenecarbamoylamino)pentanoic acid;nitric acid (PubChem CID 131884668) has the molecular formula C7H16N6O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylidenecarbamoylamino)pentanoic acid;nitric acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylidenecarbamoylamino)pentanoic acid;nitric acid |
|---|---|
| PubChem CID | 131884668 |
| Molecular Formula | C7H16N6O6 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylidenecarbamoylamino)pentanoic acid;nitric acid |
| SMILES | NC(N)=NC(=O)NCCC[C@H](N)C(=O)O.O=[N+]([O-])O |
| InChI | InChI=1S/C7H15N5O3.HNO3/c8-4(5(13)14)2-1-3-11-7(15)12-6(9)10;2-1(3)4/h4H,1-3,8H2,(H,13,14)(H5,9,10,11,12,15);(H,2,3,4)/t4-;/m0./s1 |
| InChIKey | ZDZBCMKPURPRDM-WCCKRBBISA-N |
| XLogP | -2.19 |
| TPSA | 220.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|