C11H25N7O6 — CID 88741926
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-amino-4-(diaminomethylideneamino)oxybutanoic acid (PubChem CID 88741926) has the molecular formula C11H25N7O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-amino-4-(diaminomethylideneamino)oxybutanoic acid.
| Compound Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-amino-4-(diaminomethylideneamino)oxybutanoic acid |
|---|---|
| PubChem CID | 88741926 |
| Molecular Formula | C11H25N7O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-amino-4-(diaminomethylideneamino)oxybutanoic acid |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)O.NC(N)=NOCCC(N)C(=O)O |
| InChI | InChI=1S/C6H13N3O3.C5H12N4O3/c7-4(5(10)11)2-1-3-9-6(8)12;6-3(4(10)11)1-2-12-9-5(7)8/h4H,1-3,7H2,(H,10,11)(H3,8,9,12);3H,1-2,6H2,(H,10,11)(H4,7,8,9)/t4-;/m0./s1 |
| InChIKey | ACMXRDBNZJNTEL-WCCKRBBISA-N |
| XLogP | -3.16 |
| TPSA | 255.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|