C10H21N3O6 — CID 90459681
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid (PubChem CID 90459681) has the molecular formula C10H21N3O6 and a molecular weight of 279.29 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid.
| Compound Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 90459681 |
| Molecular Formula | C10H21N3O6 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid |
| SMILES | CC(O)CC(=O)O.NC(=O)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13N3O3.C4H8O3/c7-4(5(10)11)2-1-3-9-6(8)12;1-3(5)2-4(6)7/h4H,1-3,7H2,(H,10,11)(H3,8,9,12);3,5H,2H2,1H3,(H,6,7)/t4-;/m0./s1 |
| InChIKey | OCHJVUQQTIQKIK-WCCKRBBISA-N |
| XLogP | -1.31 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|