(2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid

C10H21N3O6 — CID 90459681

IUPAC(2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid
SMILESCC(O)CC(=O)O.NC(=O)NCCC[C@H](N)C(=O)O
InChIInChI=1S/C6H13N3O3.C4H8O3/c7-4(5(10)11)2-1-3-9-6(8)12;1-3(5)2-4(6)7/h4H,1-3,7H2,(H,10,11)(H3,8,9,12);3,5H,2H2,1H3,(H,6,7)/t4-;/m0./s1
InChIKeyOCHJVUQQTIQKIK-WCCKRBBISA-N
MW279.29 g/mol
LogP-1.31
Rot. Bonds7

About (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid

(2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid (PubChem CID 90459681) has the molecular formula C10H21N3O6 and a molecular weight of 279.29 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid
PubChem CID90459681
Molecular FormulaC10H21N3O6
Molecular Weight279.29 g/mol
Exact Mass279.14
IUPAC Name(2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid
SMILESCC(O)CC(=O)O.NC(=O)NCCC[C@H](N)C(=O)O
InChIInChI=1S/C6H13N3O3.C4H8O3/c7-4(5(10)11)2-1-3-9-6(8)12;1-3(5)2-4(6)7/h4H,1-3,7H2,(H,10,11)(H3,8,9,12);3,5H,2H2,1H3,(H,6,7)/t4-;/m0./s1
InChIKeyOCHJVUQQTIQKIK-WCCKRBBISA-N
XLogP-1.31
TPSA175.97 Ų
H-Bond Donors6
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500279.29
LogP ≤ 5-1.31
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid?
The IUPAC name of (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid (CID 90459681) is (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid.
What is the SMILES notation for (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid?
The canonical SMILES for (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid is CC(O)CC(=O)O.NC(=O)NCCC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid?
The InChIKey is OCHJVUQQTIQKIK-WCCKRBBISA-N. The full InChI is InChI=1S/C6H13N3O3.C4H8O3/c7-4(5(10)11)2-1-3-9-6(8)12;1-3(5)2-4(6)7/h4H,1-3,7H2,(H,10,11)(H3,8,9,12);3,5H,2H2,1H3,(H,6,7)/t4-;/m0./s1.
What are the key properties of (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid?
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid has a molecular weight of 279.29 g/mol, XLogP of -1.31, 7 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-5-(carbamoylamino)pentanoic acid;3-hydroxybutanoic acid is sourced from PubChem (CID 90459681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).