C12H22N4O6 — CID 175605843
3,5-diamino-6-[[(5S)-5-amino-5-carboxypentyl]amino]-4,6-dioxohexanoic acid (PubChem CID 175605843) has the molecular formula C12H22N4O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 3,5-diamino-6-[[(5S)-5-amino-5-carboxypentyl]amino]-4,6-dioxohexanoic acid.
| Compound Name | 3,5-diamino-6-[[(5S)-5-amino-5-carboxypentyl]amino]-4,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 175605843 |
| Molecular Formula | C12H22N4O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3,5-diamino-6-[[(5S)-5-amino-5-carboxypentyl]amino]-4,6-dioxohexanoic acid |
| SMILES | NC(CC(=O)O)C(=O)C(N)C(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H22N4O6/c13-6(12(21)22)3-1-2-4-16-11(20)9(15)10(19)7(14)5-8(17)18/h6-7,9H,1-5,13-15H2,(H,16,20)(H,17,18)(H,21,22)/t6-,7?,9?/m0/s1 |
| InChIKey | KPWKEOLDZMBSSD-PTNSZRNDSA-N |
| XLogP | -2.62 |
| TPSA | 198.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|