C11H20BrN3O4 — CID 87235334
(2S)-2-amino-6-[2-[(2-bromoacetyl)amino]propanoylamino]hexanoic acid (PubChem CID 87235334) has the molecular formula C11H20BrN3O4 and a molecular weight of 338.20 g/mol. Its IUPAC name is (2S)-2-amino-6-[2-[(2-bromoacetyl)amino]propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[2-[(2-bromoacetyl)amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 87235334 |
| Molecular Formula | C11H20BrN3O4 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | (2S)-2-amino-6-[2-[(2-bromoacetyl)amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)CBr)C(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H20BrN3O4/c1-7(15-9(16)6-12)10(17)14-5-3-2-4-8(13)11(18)19/h7-8H,2-6,13H2,1H3,(H,14,17)(H,15,16)(H,18,19)/t7?,8-/m0/s1 |
| InChIKey | SYLOPBBWQORYHY-MQWKRIRWSA-N |
| XLogP | -0.42 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|