C11H21N3O3S — CID 54757798
(2S)-2-[[(2S)-2-amino-6-(ethanethioylamino)hexanoyl]amino]propanoic acid (PubChem CID 54757798) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-6-(ethanethioylamino)hexanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-6-(ethanethioylamino)hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54757798 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-6-(ethanethioylamino)hexanoyl]amino]propanoic acid |
| SMILES | CC(=S)NCCCC[C@H](N)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C11H21N3O3S/c1-7(11(16)17)14-10(15)9(12)5-3-4-6-13-8(2)18/h7,9H,3-6,12H2,1-2H3,(H,13,18)(H,14,15)(H,16,17)/t7-,9-/m0/s1 |
| InChIKey | HHAZVZXATUWVEK-CBAPKCEASA-N |
| XLogP | 0.01 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|