C18H27N3O4 — CID 11233376
(2S)-2-[[(2S)-2-amino-6-(3-phenylpropanoylamino)hexanoyl]amino]propanoic acid (PubChem CID 11233376) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-6-(3-phenylpropanoylamino)hexanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-6-(3-phenylpropanoylamino)hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11233376 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-6-(3-phenylpropanoylamino)hexanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)CCCCNC(=O)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H27N3O4/c1-13(18(24)25)21-17(23)15(19)9-5-6-12-20-16(22)11-10-14-7-3-2-4-8-14/h2-4,7-8,13,15H,5-6,9-12,19H2,1H3,(H,20,22)(H,21,23)(H,24,25)/t13-,15-/m0/s1 |
| InChIKey | VAKWWYVFDGCYRK-ZFWWWQNUSA-N |
| XLogP | 0.82 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|