C14H23N3O4 — CID 178180103
(2S)-2-[[(2S)-2-amino-6-(pent-4-ynoylamino)hexanoyl]amino]propanoic acid (PubChem CID 178180103) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-6-(pent-4-ynoylamino)hexanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-6-(pent-4-ynoylamino)hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 178180103 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-6-(pent-4-ynoylamino)hexanoyl]amino]propanoic acid |
| SMILES | C#CCCC(=O)NCCCC[C@H](N)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C14H23N3O4/c1-3-4-8-12(18)16-9-6-5-7-11(15)13(19)17-10(2)14(20)21/h1,10-11H,4-9,15H2,2H3,(H,16,18)(H,17,19)(H,20,21)/t10-,11-/m0/s1 |
| InChIKey | FPOXTUKLPODGTJ-QWRGUYRKSA-N |
| XLogP | -0.40 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|