C17H29N3O6S — CID 87182742
[(5S)-5-amino-6-oxo-6-[[(2S)-1-phenylpropan-2-yl]amino]hexyl]carbamic acid;methanesulfonic acid (PubChem CID 87182742) has the molecular formula C17H29N3O6S and a molecular weight of 403.50 g/mol. Its IUPAC name is [(5S)-5-amino-6-oxo-6-[[(2S)-1-phenylpropan-2-yl]amino]hexyl]carbamic acid;methanesulfonic acid.
| Compound Name | [(5S)-5-amino-6-oxo-6-[[(2S)-1-phenylpropan-2-yl]amino]hexyl]carbamic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 87182742 |
| Molecular Formula | C17H29N3O6S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [(5S)-5-amino-6-oxo-6-[[(2S)-1-phenylpropan-2-yl]amino]hexyl]carbamic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.C[C@@H](Cc1ccccc1)NC(=O)[C@@H](N)CCCCNC(=O)O |
| InChI | InChI=1S/C16H25N3O3.CH4O3S/c1-12(11-13-7-3-2-4-8-13)19-15(20)14(17)9-5-6-10-18-16(21)22;1-5(2,3)4/h2-4,7-8,12,14,18H,5-6,9-11,17H2,1H3,(H,19,20)(H,21,22);1H3,(H,2,3,4)/t12-,14-;/m0./s1 |
| InChIKey | XKFJHQVMWJUKBU-KYSPHBLOSA-N |
| XLogP | 1.00 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|