C18H29N5O5 — CID 25156206
2-amino-6-(diaminomethylideneamino)-N-(1-phenylpropan-2-yl)hexanamide;oxalic acid (PubChem CID 25156206) has the molecular formula C18H29N5O5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-amino-6-(diaminomethylideneamino)-N-(1-phenylpropan-2-yl)hexanamide;oxalic acid.
| Compound Name | 2-amino-6-(diaminomethylideneamino)-N-(1-phenylpropan-2-yl)hexanamide;oxalic acid |
|---|---|
| PubChem CID | 25156206 |
| Molecular Formula | C18H29N5O5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-amino-6-(diaminomethylideneamino)-N-(1-phenylpropan-2-yl)hexanamide;oxalic acid |
| SMILES | CC(Cc1ccccc1)NC(=O)C(N)CCCCN=C(N)N.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H27N5O.C2H2O4/c1-12(11-13-7-3-2-4-8-13)21-15(22)14(17)9-5-6-10-20-16(18)19;3-1(4)2(5)6/h2-4,7-8,12,14H,5-6,9-11,17H2,1H3,(H,21,22)(H4,18,19,20);(H,3,4)(H,5,6) |
| InChIKey | XAVTXEKCQUNZPE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 194.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|