C20H33N5O6 — CID 25156490
2-amino-6-(diaminomethylideneamino)-N-(1-phenylpropan-2-yl)hexanamide;2-hydroxybutanedioic acid (PubChem CID 25156490) has the molecular formula C20H33N5O6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-amino-6-(diaminomethylideneamino)-N-(1-phenylpropan-2-yl)hexanamide;2-hydroxybutanedioic acid.
| Compound Name | 2-amino-6-(diaminomethylideneamino)-N-(1-phenylpropan-2-yl)hexanamide;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 25156490 |
| Molecular Formula | C20H33N5O6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 2-amino-6-(diaminomethylideneamino)-N-(1-phenylpropan-2-yl)hexanamide;2-hydroxybutanedioic acid |
| SMILES | CC(Cc1ccccc1)NC(=O)C(N)CCCCN=C(N)N.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C16H27N5O.C4H6O5/c1-12(11-13-7-3-2-4-8-13)21-15(22)14(17)9-5-6-10-20-16(18)19;5-2(4(8)9)1-3(6)7/h2-4,7-8,12,14H,5-6,9-11,17H2,1H3,(H,21,22)(H4,18,19,20);2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | PFIXJWCLTWVWLM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 214.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|