C16H26N6O3 — CID 153352397
2-amino-6-[[(Z)-N'-nitrocarbamimidoyl]amino]-N-(1-phenylpropan-2-yl)hexanamide (PubChem CID 153352397) has the molecular formula C16H26N6O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-amino-6-[[(Z)-N'-nitrocarbamimidoyl]amino]-N-(1-phenylpropan-2-yl)hexanamide.
| Compound Name | 2-amino-6-[[(Z)-N'-nitrocarbamimidoyl]amino]-N-(1-phenylpropan-2-yl)hexanamide |
|---|---|
| PubChem CID | 153352397 |
| Molecular Formula | C16H26N6O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-amino-6-[[(Z)-N'-nitrocarbamimidoyl]amino]-N-(1-phenylpropan-2-yl)hexanamide |
| SMILES | CC(Cc1ccccc1)NC(=O)C(N)CCCCN/C(N)=N\[N+](=O)[O-] |
| InChI | InChI=1S/C16H26N6O3/c1-12(11-13-7-3-2-4-8-13)20-15(23)14(17)9-5-6-10-19-16(18)21-22(24)25/h2-4,7-8,12,14H,5-6,9-11,17H2,1H3,(H,20,23)(H3,18,19,21) |
| InChIKey | NVURAXOERCEDQF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|