C16H24N6O5 — CID 135996673
methyl (2S)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate (PubChem CID 135996673) has the molecular formula C16H24N6O5 and a molecular weight of 380.41 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 135996673 |
| Molecular Formula | C16H24N6O5 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CCCN/C(N)=N/[N+](=O)[O-])NC(=O)[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C16H24N6O5/c1-27-15(24)13(8-5-9-19-16(18)21-22(25)26)20-14(23)12(17)10-11-6-3-2-4-7-11/h2-4,6-7,12-13H,5,8-10,17H2,1H3,(H,20,23)(H3,18,19,21)/t12-,13+/m1/s1 |
| InChIKey | DRSRVBDYFUDJCK-OLZOCXBDSA-N |
| XLogP | -0.91 |
| TPSA | 174.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|