C23H30N6O7S — CID 173193466
(2S)-5-[(N'-nitrocarbamimidoyl)amino]-2-[[(2R)-3-phenyl-2-(2-phenylethylsulfonylamino)propanoyl]amino]pentanoic acid (PubChem CID 173193466) has the molecular formula C23H30N6O7S and a molecular weight of 534.60 g/mol. Its IUPAC name is (2S)-5-[(N'-nitrocarbamimidoyl)amino]-2-[[(2R)-3-phenyl-2-(2-phenylethylsulfonylamino)propanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-[(N'-nitrocarbamimidoyl)amino]-2-[[(2R)-3-phenyl-2-(2-phenylethylsulfonylamino)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 173193466 |
| Molecular Formula | C23H30N6O7S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (2S)-5-[(N'-nitrocarbamimidoyl)amino]-2-[[(2R)-3-phenyl-2-(2-phenylethylsulfonylamino)propanoyl]amino]pentanoic acid |
| SMILES | NC(=N[N+](=O)[O-])NCCC[C@H](NC(=O)[C@@H](Cc1ccccc1)NS(=O)(=O)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H30N6O7S/c24-23(27-29(33)34)25-14-7-12-19(22(31)32)26-21(30)20(16-18-10-5-2-6-11-18)28-37(35,36)15-13-17-8-3-1-4-9-17/h1-6,8-11,19-20,28H,7,12-16H2,(H,26,30)(H,31,32)(H3,24,25,27)/t19-,20+/m0/s1 |
| InChIKey | JIXFYZVMHVERKS-VQTJNVASSA-N |
| XLogP | 0.21 |
| TPSA | 206.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|