C27H36N6O6 — CID 89358993
4-amino-5-[[1-[[1-carboxy-4-[(N'-methylcarbamimidoyl)amino]butyl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 89358993) has the molecular formula C27H36N6O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-carboxy-4-[(N'-methylcarbamimidoyl)amino]butyl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-carboxy-4-[(N'-methylcarbamimidoyl)amino]butyl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 89358993 |
| Molecular Formula | C27H36N6O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 4-amino-5-[[1-[[1-carboxy-4-[(N'-methylcarbamimidoyl)amino]butyl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | C/N=C(\N)NCCCC(NC(=O)C(Cc1ccc(-c2ccccc2)cc1)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H36N6O6/c1-30-27(29)31-15-5-8-21(26(38)39)32-25(37)22(33-24(36)20(28)13-14-23(34)35)16-17-9-11-19(12-10-17)18-6-3-2-4-7-18/h2-4,6-7,9-12,20-22H,5,8,13-16,28H2,1H3,(H,32,37)(H,33,36)(H,34,35)(H,38,39)(H3,29,30,31) |
| InChIKey | ULINSNJNUMWCTP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 209.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|