C27H41N7O9 — CID 135996674
methyl (2S)-2-[[(2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]-3-phenylpropanoyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate (PubChem CID 135996674) has the molecular formula C27H41N7O9 and a molecular weight of 607.67 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]-3-phenylpropanoyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]-3-phenylpropanoyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 135996674 |
| Molecular Formula | C27H41N7O9 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enoxypropanoyl]amino]-3-phenylpropanoyl]amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoate |
| SMILES | C=CCOC[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CCCN/C(N)=N/[N+](=O)[O-])C(=O)OC |
| InChI | InChI=1S/C27H41N7O9/c1-6-15-42-17-21(32-26(38)43-27(2,3)4)23(36)31-20(16-18-11-8-7-9-12-18)22(35)30-19(24(37)41-5)13-10-14-29-25(28)33-34(39)40/h6-9,11-12,19-21H,1,10,13-17H2,2-5H3,(H,30,35)(H,31,36)(H,32,38)(H3,28,29,33)/t19-,20+,21-/m0/s1 |
| InChIKey | XLQATXWNPIFBLH-HBMCJLEFSA-N |
| XLogP | 0.34 |
| TPSA | 225.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|