C25H35N7O6 — CID 173193455
tert-butyl N-[(2R)-1-[[(2S)-1-(methylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]carbamate (PubChem CID 173193455) has the molecular formula C25H35N7O6 and a molecular weight of 529.60 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[(2S)-1-(methylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[(2S)-1-(methylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 173193455 |
| Molecular Formula | C25H35N7O6 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[(2S)-1-(methylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CNC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)[C@@H](CCCNC(N)=N[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H35N7O6/c1-25(2,3)38-24(35)30-19(10-7-13-28-23(26)31-32(36)37)22(34)29-20(21(33)27-4)15-16-11-12-17-8-5-6-9-18(17)14-16/h5-6,8-9,11-12,14,19-20H,7,10,13,15H2,1-4H3,(H,27,33)(H,29,34)(H,30,35)(H3,26,28,31)/t19-,20+/m1/s1 |
| InChIKey | IWPLOIJQKNXRHL-UXHICEINSA-N |
| XLogP | 1.38 |
| TPSA | 190.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|