C13H26N6O6 — CID 135494338
tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 135494338) has the molecular formula C13H26N6O6 and a molecular weight of 362.39 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 135494338 |
| Molecular Formula | C13H26N6O6 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CON(C)C(=O)[C@H](CCCN/C(N)=N/[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26N6O6/c1-13(2,3)25-12(21)16-9(10(20)18(4)24-5)7-6-8-15-11(14)17-19(22)23/h9H,6-8H2,1-5H3,(H,16,21)(H3,14,15,17)/t9-/m0/s1 |
| InChIKey | YSVLDKDEZCCQLN-VIFPVBQESA-N |
| XLogP | -0.22 |
| TPSA | 161.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|