C14H26N2O6 — CID 73006760
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropentanoate (PubChem CID 73006760) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropentanoate.
| Compound Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropentanoate |
|---|---|
| PubChem CID | 73006760 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropentanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCC[N+](=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26N2O6/c1-13(2,3)21-11(17)10(8-7-9-16(19)20)15-12(18)22-14(4,5)6/h10H,7-9H2,1-6H3,(H,15,18) |
| InChIKey | GTZPWXOLLLSOOT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|