C14H27N3O5 — CID 10591867
methylimino-[(3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-1,1-ditritiobutyl]-oxidoazanium (PubChem CID 10591867) has the molecular formula C14H27N3O5 and a molecular weight of 321.40 g/mol. Its IUPAC name is methylimino-[(3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-1,1-ditritiobutyl]-oxidoazanium.
| Compound Name | methylimino-[(3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-1,1-ditritiobutyl]-oxidoazanium |
|---|---|
| PubChem CID | 10591867 |
| Molecular Formula | C14H27N3O5 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | methylimino-[(3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-1,1-ditritiobutyl]-oxidoazanium |
| SMILES | [3H]C([3H])(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)/[N+]([O-])=N/C |
| InChI | InChI=1S/C14H27N3O5/c1-13(2,3)21-11(18)10(8-9-17(20)15-7)16-12(19)22-14(4,5)6/h10H,8-9H2,1-7H3,(H,16,19)/b17-15-/t10-/m0/s1/i9T2 |
| InChIKey | TVBWLBMGTIIHBY-HZTFUTFZSA-N |
| XLogP | 2.20 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|