C15H28ClNO5 — CID 73294082
tert-butyl (2S,5S)-5-chloro-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 73294082) has the molecular formula C15H28ClNO5 and a molecular weight of 337.84 g/mol. Its IUPAC name is tert-butyl (2S,5S)-5-chloro-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | tert-butyl (2S,5S)-5-chloro-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 73294082 |
| Molecular Formula | C15H28ClNO5 |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl (2S,5S)-5-chloro-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC[C@H](Cl)CO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28ClNO5/c1-14(2,3)21-12(19)11(8-7-10(16)9-18)17-13(20)22-15(4,5)6/h10-11,18H,7-9H2,1-6H3,(H,17,20)/t10-,11-/m0/s1 |
| InChIKey | RBVCSIDKCWGHTO-QWRGUYRKSA-N |
| XLogP | 2.60 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|