C16H30ClNO4S — CID 51355464
tert-butyl (2R)-4-(3-chloropropylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 51355464) has the molecular formula C16H30ClNO4S and a molecular weight of 367.94 g/mol. Its IUPAC name is tert-butyl (2R)-4-(3-chloropropylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | tert-butyl (2R)-4-(3-chloropropylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 51355464 |
| Molecular Formula | C16H30ClNO4S |
| Molecular Weight | 367.94 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | tert-butyl (2R)-4-(3-chloropropylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCSCCCCl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30ClNO4S/c1-15(2,3)21-13(19)12(8-11-23-10-7-9-17)18-14(20)22-16(4,5)6/h12H,7-11H2,1-6H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | CMIQRLVKAJLADK-GFCCVEGCSA-N |
| XLogP | 3.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.94 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|