C17H34ClN3O4S — CID 146158897
tert-butyl 4-[2-(1-aminoethylideneamino)ethylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride (PubChem CID 146158897) has the molecular formula C17H34ClN3O4S and a molecular weight of 412.00 g/mol. Its IUPAC name is tert-butyl 4-[2-(1-aminoethylideneamino)ethylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride.
| Compound Name | tert-butyl 4-[2-(1-aminoethylideneamino)ethylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride |
|---|---|
| PubChem CID | 146158897 |
| Molecular Formula | C17H34ClN3O4S |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | tert-butyl 4-[2-(1-aminoethylideneamino)ethylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride |
| SMILES | C/C(N)=N\CCSCCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C17H33N3O4S.ClH/c1-12(18)19-9-11-25-10-8-13(14(21)23-16(2,3)4)20-15(22)24-17(5,6)7;/h13H,8-11H2,1-7H3,(H2,18,19)(H,20,22);1H |
| InChIKey | MZWYXDXTOWBMLE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|