C25H46N4O8 — CID 134235361
tert-butyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 134235361) has the molecular formula C25H46N4O8 and a molecular weight of 530.66 g/mol. Its IUPAC name is tert-butyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | tert-butyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 134235361 |
| Molecular Formula | C25H46N4O8 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | tert-butyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H46N4O8/c1-22(2,3)34-17(30)16(27-19(31)35-23(4,5)6)14-13-15-26-18(28-20(32)36-24(7,8)9)29-21(33)37-25(10,11)12/h16H,13-15H2,1-12H3,(H,27,31)(H2,26,28,29,32,33) |
| InChIKey | LYYQPDHQZODSSU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|