C23H44N4O6 — CID 155326284
tert-butyl N-[(3S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-methylhexan-3-yl]carbamate (PubChem CID 155326284) has the molecular formula C23H44N4O6 and a molecular weight of 472.63 g/mol. Its IUPAC name is tert-butyl N-[(3S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-methylhexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-methylhexan-3-yl]carbamate |
|---|---|
| PubChem CID | 155326284 |
| Molecular Formula | C23H44N4O6 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | tert-butyl N-[(3S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-methylhexan-3-yl]carbamate |
| SMILES | CC(C)[C@H](CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H44N4O6/c1-15(2)16(25-18(28)31-21(3,4)5)13-12-14-24-17(26-19(29)32-22(6,7)8)27-20(30)33-23(9,10)11/h15-16H,12-14H2,1-11H3,(H,25,28)(H2,24,26,27,29,30)/t16-/m0/s1 |
| InChIKey | AHWIRECUXOAIFM-INIZCTEOSA-N |
| XLogP | 4.72 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|