C15H27N3O5S — CID 57040909
4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]butanethioic S-acid (PubChem CID 57040909) has the molecular formula C15H27N3O5S and a molecular weight of 361.46 g/mol. Its IUPAC name is 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]butanethioic S-acid.
| Compound Name | 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]butanethioic S-acid |
|---|---|
| PubChem CID | 57040909 |
| Molecular Formula | C15H27N3O5S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]butanethioic S-acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCC(=O)S)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O5S/c1-14(2,3)22-12(20)17-11(16-9-7-8-10(19)24)18-13(21)23-15(4,5)6/h7-9H2,1-6H3,(H,19,24)(H2,16,17,18,20,21) |
| InChIKey | WEDOVVBJPKVXRF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|