C19H37N5O5 — CID 137464968
tert-butyl N-[N'-[5-amino-6-(dimethylamino)-6-oxohexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 137464968) has the molecular formula C19H37N5O5 and a molecular weight of 415.54 g/mol. Its IUPAC name is tert-butyl N-[N'-[5-amino-6-(dimethylamino)-6-oxohexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[5-amino-6-(dimethylamino)-6-oxohexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 137464968 |
| Molecular Formula | C19H37N5O5 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | tert-butyl N-[N'-[5-amino-6-(dimethylamino)-6-oxohexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CN(C)C(=O)C(N)CCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H37N5O5/c1-18(2,3)28-16(26)22-15(23-17(27)29-19(4,5)6)21-12-10-9-11-13(20)14(25)24(7)8/h13H,9-12,20H2,1-8H3,(H2,21,22,23,26,27) |
| InChIKey | WYCLZUZPOUVEQX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|