C22H40N4O7S — CID 121313413
(2S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioic S-acid (PubChem CID 121313413) has the molecular formula C22H40N4O7S and a molecular weight of 504.65 g/mol. Its IUPAC name is (2S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioic S-acid.
| Compound Name | (2S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioic S-acid |
|---|---|
| PubChem CID | 121313413 |
| Molecular Formula | C22H40N4O7S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | (2S)-6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioic S-acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)S)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H40N4O7S/c1-20(2,3)31-17(28)24-14(15(27)34)12-10-11-13-23-16(25-18(29)32-21(4,5)6)26-19(30)33-22(7,8)9/h14H,10-13H2,1-9H3,(H,24,28)(H,27,34)(H2,23,25,26,29,30)/t14-/m0/s1 |
| InChIKey | IYDKIXQRTFONDC-AWEZNQCLSA-N |
| XLogP | 3.91 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|