C25H48N6O7S2 — CID 88559431
tert-butyl N-[1-[2-(2-aminoethyldisulfanyl)ethylamino]-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-oxopentan-2-yl]carbamate (PubChem CID 88559431) has the molecular formula C25H48N6O7S2 and a molecular weight of 608.83 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(2-aminoethyldisulfanyl)ethylamino]-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(2-aminoethyldisulfanyl)ethylamino]-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 88559431 |
| Molecular Formula | C25H48N6O7S2 |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | tert-butyl N-[1-[2-(2-aminoethyldisulfanyl)ethylamino]-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCC(NC(=O)OC(C)(C)C)C(=O)NCCSSCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H48N6O7S2/c1-23(2,3)36-20(33)29-17(18(32)27-14-16-40-39-15-12-26)11-10-13-28-19(30-21(34)37-24(4,5)6)31-22(35)38-25(7,8)9/h17H,10-16,26H2,1-9H3,(H,27,32)(H,29,33)(H2,28,30,31,34,35) |
| InChIKey | DVXPDTOWIULRPV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 182.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|