C14H27N5O5 — CID 146381888
(2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoic acid (PubChem CID 146381888) has the molecular formula C14H27N5O5 and a molecular weight of 345.40 g/mol. Its IUPAC name is (2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146381888 |
| Molecular Formula | C14H27N5O5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | (2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](CCCN=C(N)N)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H27N5O5/c1-8(11(21)22)18-10(20)9(6-5-7-17-12(15)16)19-13(23)24-14(2,3)4/h8-9H,5-7H2,1-4H3,(H,18,20)(H,19,23)(H,21,22)(H4,15,16,17)/t8-,9+/m0/s1 |
| InChIKey | ANRNWTPZEWDMBN-DTWKUNHWSA-N |
| XLogP | -0.48 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|