C14H28N4O6 — CID 11811104
2,3-dihydroxypropyl (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 11811104) has the molecular formula C14H28N4O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | 2,3-dihydroxypropyl (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 11811104 |
| Molecular Formula | C14H28N4O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2,3-dihydroxypropyl (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN=C(N)N)C(=O)OCC(O)CO |
| InChI | InChI=1S/C14H28N4O6/c1-14(2,3)24-13(22)18-10(5-4-6-17-12(15)16)11(21)23-8-9(20)7-19/h9-10,19-20H,4-8H2,1-3H3,(H,18,22)(H4,15,16,17)/t9?,10-/m0/s1 |
| InChIKey | JSCUJCZWQJEFNY-AXDSSHIGSA-N |
| XLogP | -1.17 |
| TPSA | 169.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|