C16H29N5O6 — CID 130322776
(4-oxo-1,3-oxazepan-3-yl) 5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 130322776) has the molecular formula C16H29N5O6 and a molecular weight of 387.44 g/mol. Its IUPAC name is (4-oxo-1,3-oxazepan-3-yl) 5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | (4-oxo-1,3-oxazepan-3-yl) 5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 130322776 |
| Molecular Formula | C16H29N5O6 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | (4-oxo-1,3-oxazepan-3-yl) 5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCCN=C(N)N)C(=O)ON1COCCCC1=O |
| InChI | InChI=1S/C16H29N5O6/c1-16(2,3)26-15(24)20-11(6-4-8-19-14(17)18)13(23)27-21-10-25-9-5-7-12(21)22/h11H,4-10H2,1-3H3,(H,20,24)(H4,17,18,19) |
| InChIKey | OVGNGPJRSZJEJF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|