C15H23N5O6 — CID 140607704
(2,5-dioxopyrrolidin-1-yl) (2S)-6-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 140607704) has the molecular formula C15H23N5O6 and a molecular weight of 369.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-6-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 140607704 |
| Molecular Formula | C15H23N5O6 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H23N5O6/c1-15(2,3)25-14(24)18-10(6-4-5-9-17-19-16)13(23)26-20-11(21)7-8-12(20)22/h10H,4-9H2,1-3H3,(H,18,24)/t10-/m0/s1 |
| InChIKey | DOKAQDNMFNWIOP-JTQLQIEISA-N |
| XLogP | 1.97 |
| TPSA | 150.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|