C10H18N4O4 — CID 23385789
methyl 4-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 23385789) has the molecular formula C10H18N4O4 and a molecular weight of 258.28 g/mol. Its IUPAC name is methyl 4-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl 4-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 23385789 |
| Molecular Formula | C10H18N4O4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | methyl 4-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)C(CCN=[N+]=[N-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18N4O4/c1-10(2,3)18-9(16)13-7(8(15)17-4)5-6-12-14-11/h7H,5-6H2,1-4H3,(H,13,16) |
| InChIKey | YZQHQNKUOJENPQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|