C11H20N4O5 — CID 10989838
methyl (2S,3R)-5-azido-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 10989838) has the molecular formula C11H20N4O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl (2S,3R)-5-azido-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl (2S,3R)-5-azido-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 10989838 |
| Molecular Formula | C11H20N4O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | methyl (2S,3R)-5-azido-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | COC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@H](O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C11H20N4O5/c1-11(2,3)20-10(18)14-8(9(17)19-4)7(16)5-6-13-15-12/h7-8,16H,5-6H2,1-4H3,(H,14,18)/t7-,8+/m1/s1 |
| InChIKey | ZSWLCUHLUWPJBG-SFYZADRCSA-N |
| XLogP | 1.11 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|