C10H16N6O4 — CID 59749614
dimethyl (2R,3S)-2,3-bis(2-azidoethyl)butanedioate (PubChem CID 59749614) has the molecular formula C10H16N6O4 and a molecular weight of 284.28 g/mol. Its IUPAC name is dimethyl (2R,3S)-2,3-bis(2-azidoethyl)butanedioate.
| Compound Name | dimethyl (2R,3S)-2,3-bis(2-azidoethyl)butanedioate |
|---|---|
| PubChem CID | 59749614 |
| Molecular Formula | C10H16N6O4 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | dimethyl (2R,3S)-2,3-bis(2-azidoethyl)butanedioate |
| SMILES | COC(=O)[C@@H](CCN=[N+]=[N-])[C@@H](CCN=[N+]=[N-])C(=O)OC |
| InChI | InChI=1S/C10H16N6O4/c1-19-9(17)7(3-5-13-15-11)8(10(18)20-2)4-6-14-16-12/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | AKWWPRXFIIDCEM-OCAPTIKFSA-N |
| XLogP | 1.97 |
| TPSA | 150.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|