C10H20N4O2 — CID 66191015
methyl 2-(2-azidoethylamino)-4,4-dimethylpentanoate (PubChem CID 66191015) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is methyl 2-(2-azidoethylamino)-4,4-dimethylpentanoate.
| Compound Name | methyl 2-(2-azidoethylamino)-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 66191015 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | methyl 2-(2-azidoethylamino)-4,4-dimethylpentanoate |
| SMILES | COC(=O)C(CC(C)(C)C)NCCN=[N+]=[N-] |
| InChI | InChI=1S/C10H20N4O2/c1-10(2,3)7-8(9(15)16-4)12-5-6-13-14-11/h8,12H,5-7H2,1-4H3 |
| InChIKey | ABRNJXBNTJYSHH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|