C9H19N5O — CID 66190065
2-(2-azidoethylamino)-4,4-dimethylpentanamide (PubChem CID 66190065) has the molecular formula C9H19N5O and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-4,4-dimethylpentanamide.
| Compound Name | 2-(2-azidoethylamino)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 66190065 |
| Molecular Formula | C9H19N5O |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2-(2-azidoethylamino)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(NCCN=[N+]=[N-])C(N)=O |
| InChI | InChI=1S/C9H19N5O/c1-9(2,3)6-7(8(10)15)12-4-5-13-14-11/h7,12H,4-6H2,1-3H3,(H2,10,15) |
| InChIKey | DVBAMCBTGBXZLW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|