C14H29N5O2 — CID 176583516
tert-butyl (2S)-4-(2-azidoethylamino)-2-(tert-butylamino)butanoate (PubChem CID 176583516) has the molecular formula C14H29N5O2 and a molecular weight of 299.42 g/mol. Its IUPAC name is tert-butyl (2S)-4-(2-azidoethylamino)-2-(tert-butylamino)butanoate.
| Compound Name | tert-butyl (2S)-4-(2-azidoethylamino)-2-(tert-butylamino)butanoate |
|---|---|
| PubChem CID | 176583516 |
| Molecular Formula | C14H29N5O2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | tert-butyl (2S)-4-(2-azidoethylamino)-2-(tert-butylamino)butanoate |
| SMILES | CC(C)(C)N[C@@H](CCNCCN=[N+]=[N-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29N5O2/c1-13(2,3)18-11(12(20)21-14(4,5)6)7-8-16-9-10-17-19-15/h11,16,18H,7-10H2,1-6H3/t11-/m0/s1 |
| InChIKey | CERJVQWTTKFKHH-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|