C14H28N6O3 — CID 168911676
tert-butyl N-[(5R)-5-amino-6-(3-azidopropylamino)-6-oxohexyl]carbamate (PubChem CID 168911676) has the molecular formula C14H28N6O3 and a molecular weight of 328.42 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-amino-6-(3-azidopropylamino)-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-amino-6-(3-azidopropylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 168911676 |
| Molecular Formula | C14H28N6O3 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl N-[(5R)-5-amino-6-(3-azidopropylamino)-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](N)C(=O)NCCCN=[N+]=[N-] |
| InChI | InChI=1S/C14H28N6O3/c1-14(2,3)23-13(22)18-8-5-4-7-11(15)12(21)17-9-6-10-19-20-16/h11H,4-10,15H2,1-3H3,(H,17,21)(H,18,22)/t11-/m1/s1 |
| InChIKey | UIPRJAPZMFSWLP-LLVKDONJSA-N |
| XLogP | 1.83 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|