C20H39N3O5 — CID 131716853
tert-butyl (2S)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-methylbutanoate (PubChem CID 131716853) has the molecular formula C20H39N3O5 and a molecular weight of 401.55 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 131716853 |
| Molecular Formula | C20H39N3O5 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CCCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39N3O5/c1-13(2)15(17(25)27-19(3,4)5)23-16(24)14(21)11-9-10-12-22-18(26)28-20(6,7)8/h13-15H,9-12,21H2,1-8H3,(H,22,26)(H,23,24)/t14-,15-/m0/s1 |
| InChIKey | AMLDUMWVVHAJEA-GJZGRUSLSA-N |
| XLogP | 2.49 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|