C18H36N2O4 — CID 139570514
tert-butyl N-[2-methyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptan-3-yl]carbamate (PubChem CID 139570514) has the molecular formula C18H36N2O4 and a molecular weight of 344.50 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 139570514 |
| Molecular Formula | C18H36N2O4 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | tert-butyl N-[2-methyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptan-3-yl]carbamate |
| SMILES | CC(C)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H36N2O4/c1-13(2)14(20-16(22)24-18(6,7)8)11-9-10-12-19-15(21)23-17(3,4)5/h13-14H,9-12H2,1-8H3,(H,19,21)(H,20,22) |
| InChIKey | PRXRJTUVPGQALU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|