C16H30N2O5S — CID 59548988
(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioic S-acid (PubChem CID 59548988) has the molecular formula C16H30N2O5S and a molecular weight of 362.49 g/mol. Its IUPAC name is (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioic S-acid.
| Compound Name | (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioic S-acid |
|---|---|
| PubChem CID | 59548988 |
| Molecular Formula | C16H30N2O5S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioic S-acid |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)S |
| InChI | InChI=1S/C16H30N2O5S/c1-15(2,3)22-13(20)17-10-8-7-9-11(12(19)24)18-14(21)23-16(4,5)6/h11H,7-10H2,1-6H3,(H,17,20)(H,18,21)(H,19,24)/t11-/m0/s1 |
| InChIKey | XACSAGHBBQZGGX-NSHDSACASA-N |
| XLogP | 3.03 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|