C10H18N2O4S — CID 175192087
5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanethioic S-acid (PubChem CID 175192087) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanethioic S-acid.
| Compound Name | 5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanethioic S-acid |
|---|---|
| PubChem CID | 175192087 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanethioic S-acid |
| SMILES | CC(C)(C)OC(=O)NC(CCC(N)=O)C(=O)S |
| InChI | InChI=1S/C10H18N2O4S/c1-10(2,3)16-9(15)12-6(8(14)17)4-5-7(11)13/h6H,4-5H2,1-3H3,(H2,11,13)(H,12,15)(H,14,17) |
| InChIKey | JDAFXXWUARXQAS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|