C10H21N3O3 — CID 176793158
tert-butyl N-[(2S)-1,5-diamino-5-oxopentan-2-yl]carbamate (PubChem CID 176793158) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1,5-diamino-5-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1,5-diamino-5-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 176793158 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | tert-butyl N-[(2S)-1,5-diamino-5-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN)CCC(N)=O |
| InChI | InChI=1S/C10H21N3O3/c1-10(2,3)16-9(15)13-7(6-11)4-5-8(12)14/h7H,4-6,11H2,1-3H3,(H2,12,14)(H,13,15)/t7-/m0/s1 |
| InChIKey | KCXDOCKKQLWONY-ZETCQYMHSA-N |
| XLogP | 0.10 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |