C11H19N2O5- — CID 7010014
(3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate (PubChem CID 7010014) has the molecular formula C11H19N2O5- and a molecular weight of 259.28 g/mol. Its IUPAC name is (3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate.
| Compound Name | (3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 7010014 |
| Molecular Formula | C11H19N2O5- |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(N)=O)CC(=O)[O-] |
| InChI | InChI=1S/C11H20N2O5/c1-11(2,3)18-10(17)13-7(6-9(15)16)4-5-8(12)14/h7H,4-6H2,1-3H3,(H2,12,14)(H,13,17)(H,15,16)/p-1/t7-/m0/s1 |
| InChIKey | DAUHTFNYHSOVRQ-ZETCQYMHSA-M |
| XLogP | -0.71 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |