C9H13NO6-2 — CID 22352296
2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 22352296) has the molecular formula C9H13NO6-2 and a molecular weight of 231.20 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 22352296 |
| Molecular Formula | C9H13NO6-2 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H15NO6/c1-9(2,3)16-8(15)10-5(7(13)14)4-6(11)12/h5H,4H2,1-3H3,(H,10,15)(H,11,12)(H,13,14)/p-2 |
| InChIKey | KAJBMCZQVSQJDE-UHFFFAOYSA-L |
| XLogP | -2.23 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |