C20H40N2O5S — CID 23649998
N,N-diethylethanamine;(4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanethioic S-acid (PubChem CID 23649998) has the molecular formula C20H40N2O5S and a molecular weight of 420.62 g/mol. Its IUPAC name is N,N-diethylethanamine;(4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanethioic S-acid.
| Compound Name | N,N-diethylethanamine;(4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanethioic S-acid |
|---|---|
| PubChem CID | 23649998 |
| Molecular Formula | C20H40N2O5S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | N,N-diethylethanamine;(4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanethioic S-acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)S)C(=O)OC(C)(C)C.CCN(CC)CC |
| InChI | InChI=1S/C14H25NO5S.C6H15N/c1-13(2,3)19-11(17)9(7-8-10(16)21)15-12(18)20-14(4,5)6;1-4-7(5-2)6-3/h9H,7-8H2,1-6H3,(H,15,18)(H,16,21);4-6H2,1-3H3/t9-;/m0./s1 |
| InChIKey | ALYQFBJWHIRJGN-FVGYRXGTSA-N |
| XLogP | 3.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|