C13H23N2O5- — CID 7019609
(2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 7019609) has the molecular formula C13H23N2O5- and a molecular weight of 287.34 g/mol. Its IUPAC name is (2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | (2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 7019609 |
| Molecular Formula | C13H23N2O5- |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)[O-] |
| InChI | InChI=1S/C13H24N2O5/c1-9(16)15-10(11(17)18)7-5-6-8-14-12(19)20-13(2,3)4/h10H,5-8H2,1-4H3,(H,14,19)(H,15,16)(H,17,18)/p-1/t10-/m0/s1 |
| InChIKey | NZAMQYCOJSWUAO-JTQLQIEISA-M |
| XLogP | -0.06 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|